| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Bromo-2,5-difluorobenzenesulfonyl chloride Basic information |
| | 4-Bromo-2,5-difluorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 38-42 °C (lit.) | | Boiling point | 76°C 0,01mm | | density | 1.934±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Acetone | | form | Crystalline Powder or Crystals | | color | White to yellow or orange, may darken on storage | | Sensitive | Moisture Sensitive | | InChI | 1S/C6H2BrClF2O2S/c7-3-1-5(10)6(2-4(3)9)13(8,11)12/h1-2H | | InChIKey | SBMKFWMFNIEPDN-UHFFFAOYSA-N | | SMILES | Fc1cc(c(F)cc1Br)S(Cl)(=O)=O | | CAS DataBase Reference | 207974-14-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 4-Bromo-2,5-difluorobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellow liquid |
| | 4-Bromo-2,5-difluorobenzenesulfonyl chloride Preparation Products And Raw materials |
|