| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Bromo-2,4-difluorobenzenesulfonyl chloride Basic information |
| Product Name: | 5-Bromo-2,4-difluorobenzenesulfonyl chloride | | Synonyms: | BUTTPARK 25\07-35;5-BROMO-2,4-DIFLUOROBENZENESULPHONYL CHLORIDE;5-bromo-2,5-difluorophenylsulfonyl chloride;5-Bromo-1-(chlorosulphonyl)-2,4-difluorobenzene;5-broMo-2,4-difluorophenylsulfonyl chloride;5-broMo-2,4-difluorobenzene-1-sulfonyl chloride;5-Bromo-2,4-difluorobenzenesulphonylchloride97%;Benzenesulfonyl chloride, 5-bromo-2,4-difluoro- | | CAS: | 287172-61-6 | | MF: | C6H2BrClF2O2S | | MW: | 291.5 | | EINECS: | | | Product Categories: | Benzenesulfonyl chloride | | Mol File: | 287172-61-6.mol |  |
| | 5-Bromo-2,4-difluorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 34-36 | | density | 1.934±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystalline solid | | color | White to off-white | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C6H2BrClF2O2S/c7-3-1-6(13(8,11)12)5(10)2-4(3)9/h1-2H | | InChIKey | GSNAPAYUOACKRN-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC(Br)=C(F)C=C1F | | CAS DataBase Reference | 287172-61-6(CAS DataBase Reference) |
| Hazard Codes | C,T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN3261 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | MOISTURE SENSITIVE, CORROSIVE | | HS Code | 2942000090 |
| | 5-Bromo-2,4-difluorobenzenesulfonyl chloride Usage And Synthesis |
| | 5-Bromo-2,4-difluorobenzenesulfonyl chloride Preparation Products And Raw materials |
|