| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
4-Amino-2,6-difluoropyridine manufacturers
|
| | 4-Amino-2,6-difluoropyridine Basic information |
| Product Name: | 4-Amino-2,6-difluoropyridine | | Synonyms: | 2,,6-difluoro-4-aminopyridine;4-Pyridinamine,2,6-difluoro-(9CI);6-difluoropyridin-4-aMine;4-Amino-2,6-difluoropyridine 97%;4-Pyridinamine, 2,6-difluoro-;4-AMINO-2,6-DIFLUOROPYRIDINE ISO 9001:2015 REACH;2,6-Difluoro-pyridin-4-ylamine;2,6-difluoropyridin-4-aMine | | CAS: | 63489-58-7 | | MF: | C5H4F2N2 | | MW: | 130.1 | | EINECS: | 200-589-5 | | Product Categories: | PYRIDINE | | Mol File: | 63489-58-7.mol |  |
| | 4-Amino-2,6-difluoropyridine Chemical Properties |
| Melting point | 124-125 | | Boiling point | 267.8±35.0 °C(Predicted) | | density | 1.393±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | -0.33±0.10(Predicted) | | color | Pale yellow | | InChI | InChI=1S/C5H4F2N2/c6-4-1-3(8)2-5(7)9-4/h1-2H,(H2,8,9) | | InChIKey | OWXBXLGJIFPPMS-UHFFFAOYSA-N | | SMILES | C1(F)=NC(F)=CC(N)=C1 | | CAS DataBase Reference | 63489-58-7 |
| Hazard Codes | T | | RIDADR | 2811 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2933399990 |
| | 4-Amino-2,6-difluoropyridine Usage And Synthesis |
| Synthesis Reference(s) | Journal of Medicinal Chemistry, 30, p. 340, 1987 DOI: 10.1021/jm00385a016 | | Synthesis | In a 500 mL autoclave, 49.8 g (0.25 mol) of 2,6-difluoro-3,5-dichloro-4-aminopyridine, 200 mL of ethanol, 5.61 g (0.55 mol) of triethylamine, and 10.0 g of 10% palladium carbon catalyst were added. The reaction system was maintained at 25 °C and a hydrogen pressure of 0.46 MPa was applied and the reaction lasted for 24 hours. Upon completion of the reaction, the system was cooled and the hydrogen pressure was slowly released. The catalyst was removed by diafiltration followed by distillation under reduced pressure to remove the solvent. The crude product was purified by column chromatography using petroleum ether/ethyl acetate (3:1 v/v) as eluent. The final product was 20.6 g of 2,6-difluoro-4-aminopyridine as a white solid, which was determined to be 99.7% pure by liquid chromatographic normalization in 63.5% yield. | | References | [1] Journal of Medicinal Chemistry, 1987, vol. 30, # 2, p. 340 - 347 [2] Patent: CN104610250, 2017, B. Location in patent: Paragraph 0076; 0077; 0079 |
| | 4-Amino-2,6-difluoropyridine Preparation Products And Raw materials |
|