|
|
| | Propofol-d17 Basic information |
| Product Name: | Propofol-d17 | | Synonyms: | Propofol-d17;3,4,5-trideuterio-2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenol;2,6-Bis(1-Methylethyl)phenol-d17;2,6-Bis(isopropyl)phenol-d17;2,6-Diisopropylphenol-d17;AMpofol-d17;Anepol-d17;Aquafol-d17 | | CAS: | 1261393-54-7 | | MF: | C12HD17O | | MW: | 195.38 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals | | Mol File: | 1261393-54-7.mol |  |
| | Propofol-d17 Chemical Properties |
| Boiling point | 136°C | | Fp | 9℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Colourless to Light Yellow | | Major Application | forensics and toxicology | | InChI | 1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3/i1D3,2D3,3D3,4D3,5D,6D,7D,8D,9D | | InChIKey | OLBCVFGFOZPWHH-ACWNEFEHSA-N | | SMILES | OC1=C(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])=C([2H])C([2H])=C1C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | Propofol-d17 Usage And Synthesis |
| Chemical Properties | Colorless to Light Yellow Liquid | | Uses | Propofol-d17 is an anesthetic used in veterinary medicine. | | Uses | Labelled Propofol (P829750). Propofol is an anesthetic used in veterinary medicine. |
| | Propofol-d17 Preparation Products And Raw materials |
|