|
|
| | 2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol Impurity L) Basic information |
| Product Name: | 2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol Impurity L) | | Synonyms: | 2,2-Dimethyl-4-(1-methylethyl)-1,3-benzodioxole;2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol Impurity L);2,2-dimethyl-4-propan-2-yl-1,3-benzodioxole;Propofol Impurity 12(Propofol EP Impurity L);Propofol Impurity L;4-ISOPROPYL-2,2-DIMETHYL-BENZO[1,3]DIOXOLE;4-Isopropyl-2,2-diMethylbenzo[d][1,3]dioxole;Propofol EP Impurity L | | CAS: | 201166-22-5 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | | | Product Categories: | Chemical Impurities;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 201166-22-5.mol |  |
| | 2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol Impurity L) Chemical Properties |
| Boiling point | 240.5±35.0 °C(Predicted) | | density | 1.016±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Major Application | pharmaceutical small molecule | | InChI | 1S/C12H16O2/c1-8(2)9-6-5-7-10-11(9)14-12(3,4)13-10/h5-8H,1-4H3 | | InChIKey | DHDJXCHGRUOYCV-UHFFFAOYSA-N | | SMILES | CC(C)C1=C2C(OC(C)(C)O2)=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | 2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol Impurity L) Usage And Synthesis |
| Uses | Propofol impurity L | | Uses | 2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol EP Impurity L). |
| | 2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol Impurity L) Preparation Products And Raw materials |
|