| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Pamoic acid disodium salt Basic information |
| Product Name: | Pamoic acid disodium salt | | Synonyms: | PAMOIC ACID DISODIUM SALT 98+%;DisodiumPamoate98%;DISODIUMEMBONATE;4,4μ-Methylenebis(3-hydroxy-2-naphthoic acid), Embonic acid, Sodium pamoate;2-Naphthalenecarboxylic acid, 4,4'-methylenebis[3-hydroxy-, disodium salt;Disodium 4-[(3-carboxylato-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylate;1,1'-Methylenebis(2-hydroxy-3-naphthalenecarboxylic acid sodium) salt;1,1'-Methylenebis(2-hydroxy-3-naphthalenecarboxylic acid)disodium salt | | CAS: | 6640-22-8 | | MF: | C23H17NaO6 | | MW: | 412.37 | | EINECS: | 229-653-1 | | Product Categories: | | | Mol File: | 6640-22-8.mol |  |
| | Pamoic acid disodium salt Chemical Properties |
| Melting point | 300 °C | | density | 1.55[at 20℃] | | vapor pressure | 0.001Pa at 25℃ | | storage temp. | Desiccate at RT | | solubility | insoluble in EtOH; ≥18 mg/mL in H2O; ≥28.6 mg/mL in DMSO | | form | solid | | color | Pale yellow | | Water Solubility | 43g/L at 20℃ | | InChI | 1S/C23H16O6.Na.H/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;;/h1-10,24-25H,11H2,(H,26,27)(H,28,29);; | | InChIKey | ZRZSXMUASGHHKP-UHFFFAOYSA-N | | SMILES | [Na].OC(=O)c1cc2ccccc2c(Cc3c(O)c(cc4ccccc34)C(O)=O)c1O | | LogP | -3.2 at 20℃ | | CAS DataBase Reference | 6640-22-8(CAS DataBase Reference) | | EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 4,4'-methylenebis[3-hydroxy-, disodium salt (6640-22-8) |
| | Pamoic acid disodium salt Usage And Synthesis |
| Chemical Properties | pale yellow to yellow powder | | Uses | Pamoic acid disodium salt, a supposedly inactive component in many formulations of drugs used to modulate release, is a potent agonist of the orphan receptor GPR35. GPR35 is a class A, rhodopsin-like G protein-coupled receptor (GPCR), strongly expressed in the lower intestine and colon, dorsal root ganglia, as well as a variety of immune cells including monocytes and dendritic cells. Targeting GPR35 provides potential therapeutic opportunities in a range of conditions, such as inflammation, pain and cancer. | | Flammability and Explosibility | Not classified | | Biological Activity | Pamoic acid disodium salt is a GPR35 agonist. Induces GPR35 internalization and activates ERK1/2 (EC50 values are 22 and 65 nM respectively). Mediates recruitment of β-arrestin2 to GPR35. Also exhibits antinociceptive effects in a mouse model of visceral pain. | | in vivo | Pamoic acid disodium (0-100 mg/kg; s.c.; once) induces a dose-related antinociception in the abdominal constriction test[1]. | Animal Model: | Swiss-Webster mice (30–35 g)[1] | | Dosage: | 25, 50, and 100 mg/kg | | Administration: | Subcutaneous injection, once | | Result: | Elicited dose-related antinociception, the dose causing 50% antinociception being 40.5 mg/kg. |
|
| | Pamoic acid disodium salt Preparation Products And Raw materials |
|