|
|
| | N-(2-chloropyriMidin-4-yl)-N,2,3-triMethyl-2H-indazol-6-aMine Basic information |
| Product Name: | N-(2-chloropyriMidin-4-yl)-N,2,3-triMethyl-2H-indazol-6-aMine | | Synonyms: | 2,3-dimethyl-N-(2-chloropyrimidin-4-yl)-N-methyl-2H-indazol-6-amine;BNKY007-PZ02;2H-indazole-6-aMine,N-(2-chloro
-4-pyrimidinyl)-N,2,3-trimethyl-;Pazopanib Impurity 22;N-(2-chloropyrimidin-4-yl)-N,2,3-trimethylindazol-6-amine;N-(2-chloropyriMidin-4-yl)-N,2,3-triMethyl-2H-indazol-6-aMine;2H-Indazol-6-aMine, N-(2-chloro-4-pyriMidinyl)-N,2,3-triMethyl-;6-[N-(2-chloro-4-pyriMidinyl)MethylaMino]-2,3-diMethyl-2H-indazole, 96% | | CAS: | 444731-75-3 | | MF: | C14H14ClN5 | | MW: | 287.75 | | EINECS: | 810-050-2 | | Product Categories: | | | Mol File: | 444731-75-3.mol |  |
| | N-(2-chloropyriMidin-4-yl)-N,2,3-triMethyl-2H-indazol-6-aMine Chemical Properties |
| Melting point | 167-173℃ | | Boiling point | 524.4±35.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) | | pka | 2.82±0.30(Predicted) | | Appearance | Off-white to light yellow Solid | | Stability: | Hygroscopic | | InChI | InChI=1S/C14H14ClN5/c1-9-11-5-4-10(8-12(11)18-20(9)3)19(2)13-6-7-16-14(15)17-13/h4-8H,1-3H3 | | InChIKey | DVGMRZQSSNNTFY-UHFFFAOYSA-N | | SMILES | N1=C2C(C=CC(N(C3C=CN=C(Cl)N=3)C)=C2)=C(C)N1C | | CAS DataBase Reference | 444731-75-3 |
| | N-(2-chloropyriMidin-4-yl)-N,2,3-triMethyl-2H-indazol-6-aMine Usage And Synthesis |
| Chemical Properties | Light Beige to Beige Solid | | Uses | N-(2-Chloro-4-pyrimidinyl)-N,2,3-trimethyl-2H-indazol-6-amine is an impurity of Pazopanib (P210925), an oral angiogenesis inhibitor targeting VEGFR and PDGFR. | | Synthesis | A flask was charged with N,2,3-trimethyl-2H-indazol-6-amine (1 eq.), 2,4-dichloropyrimidine (1.5 eq.), sodium bicarbonate (2 eq.) and N, N-dimethylformamide. The reaction mixture was stirred at 85 °C until completion of the reaction. Then, water was added and stirred for 3 h. Product crystals were collected by filtration, washed with water, and then dried to get N-(2-chloropyriMidin-4-yl)-N,2,3-triMethyl-2H-indazol-6-aMine as off-white/beige powder (Yield: 97%).
| | References | [1] Patent: WO2003/106416, 2003, A2. Location in patent: Page 45-46 [2] Patent: US2015/329526, 2015, A1. Location in patent: Paragraph 0039 [3] Patent: US2008/293691, 2008, A1. Location in patent: Page/Page column 10 [4] Patent: WO2007/143483, 2007, A2. Location in patent: Page/Page column 33 [5] Bioorganic and Medicinal Chemistry Letters, 2014, vol. 24, # 4, p. 1108 - 1110 |
| | N-(2-chloropyriMidin-4-yl)-N,2,3-triMethyl-2H-indazol-6-aMine Preparation Products And Raw materials |
|