|
|
| | 2-Pyridylacetic acid hydrochloride Basic information |
| | 2-Pyridylacetic acid hydrochloride Chemical Properties |
| Melting point | 135 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Crystalline Powder or Crystals | | color | White to beige | | Water Solubility | It is soluble in water. | | Sensitive | Hygroscopic | | BRN | 3696607 | | Stability: | Hygroscopic | | InChI | InChI=1S/C7H7NO2.ClH/c9-7(10)5-6-3-1-2-4-8-6;/h1-4H,5H2,(H,9,10);1H | | InChIKey | MQVISALTZUNQSK-UHFFFAOYSA-N | | SMILES | C(C1N=CC=CC=1)C(=O)O.Cl | | CAS DataBase Reference | 16179-97-8(CAS DataBase Reference) | | EPA Substance Registry System | 2-Pyridineacetic acid hydrochloride (16179-97-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | TSCA | TSCA listed | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | 2-Pyridylacetic acid hydrochloride Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | 2-Pyridineacetic acid hydrochloride is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. It is also used as an intermediate in organic synthesis. | | Uses | 2-Pyridylacetic acid hydrochloride is used in nucleophilic substitution. |
| | 2-Pyridylacetic acid hydrochloride Preparation Products And Raw materials |
|