|
|
| | 4-Pyridineacetic acid hydrochloride Basic information |
| | 4-Pyridineacetic acid hydrochloride Chemical Properties |
| Melting point | 141 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol, Water | | form | Crystalline Powder, Crystals and/or Chunks | | color | White to cream | | BRN | 3696648 | | InChI | InChI=1S/C7H7NO2.ClH/c9-7(10)5-6-1-3-8-4-2-6;/h1-4H,5H2,(H,9,10);1H | | InChIKey | WKJRYVOTVRPAFN-UHFFFAOYSA-N | | SMILES | C1(CC(=O)O)C=CN=CC=1.Cl | | CAS DataBase Reference | 6622-91-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | F | 10 | | TSCA | T | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | 4-Pyridineacetic acid hydrochloride Usage And Synthesis |
| Chemical Properties | almost white to orange powder | | Uses | 4-Pyridineacetic Acid Hydrochloride is used in the preparation of a highly tumor-selective organometallic ruthenium(II)-Arene complex. |
| | 4-Pyridineacetic acid hydrochloride Preparation Products And Raw materials |
|