AMoxicillin DiMer (penicilloic acid forM) manufacturers
|
| | AMoxicillin DiMer (penicilloic acid forM) Basic information |
| Product Name: | AMoxicillin DiMer (penicilloic acid forM) | | Synonyms: | AMoxicillin DiMer (penicilloic acid forM);Amoxicillin Related Compound J (Amoxicillin Dimer Impurity);Amoxicillin Impurity K(EP)(A Dimer);Amoxicillin Dimer Impurity;Glycine, (2R)-2-(4-hydroxyphenyl)glycyl-(2R)-2-[(2R,4S)-4-carboxy-5,5-dimethyl-2-thiazolidinyl]glycyl-(2R)-2-(4-hydroxyphenyl)glycyl-2-[(2R,4S)-4-carboxy-5,5-dimethyl-2-thiazolidinyl]-, (2R)- (9CI);Amoxicillin Impurity 36;Amoxicillin Impurity K (EP) (Open Ring Dimer);Amoxicillin Dimer Trisodium Salt | | CAS: | 210289-72-8 | | MF: | C32H40N6O11S2 | | MW: | 748.82 | | EINECS: | | | Product Categories: | | | Mol File: | 210289-72-8.mol |  |
| | AMoxicillin DiMer (penicilloic acid forM) Chemical Properties |
| Boiling point | 1202.4±65.0 °C(Predicted) | | density | 1.455±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 1.93±0.60(Predicted) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | InChIKey | YJFZGYXDUKQVQI-WSKMHKSISA-N | | SMILES | C(O)(=O)[C@H]([C@@H]1N[C@@H](C(O)=O)C(C)(C)S1)NC(=O)C(C1=CC=C(O)C=C1)NC(=O)C([C@@H]1N[C@@H](C(O)=O)C(C)(C)S1)NC(=O)C(C1=CC=C(O)C=C1)N |
| | AMoxicillin DiMer (penicilloic acid forM) Usage And Synthesis |
| Uses | Amoxicillin dimer tri-Sodium Salt (penicilloic acid form) is an impurity of Amoxicillin (A634235), a b-lactam family antibiotic that is commonly used in conjunction with clavulanic acid (C56370) to the treat bacterial infections. |
| | AMoxicillin DiMer (penicilloic acid forM) Preparation Products And Raw materials |
|