| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Resorufin-[D6] Basic information |
| Product Name: | Resorufin-[D6] | | Synonyms: | 1,2,4,6,8,9-hexadeuterio-7-hydroxyphenoxazin-3-one;RESORUFIN (D6, 98%) CHEMICAL PURITY 96%;Resorufin-d6 98 atom % D, 96% (CP);Resorufin (D6, 98%);2H6]-Resorufin;Resorufin-d6;Resorufin (D?, 98%) CP 96%;Resorufin-D6 (Standard) | | CAS: | 1196157-65-9 | | MF: | C12H7NO3 | | MW: | 213.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1196157-65-9.mol | ![Resorufin-[D6] Structure](CAS/20180629/GIF/1196157-65-9.gif) |
| | Resorufin-[D6] Chemical Properties |
| Melting point | >300°C | | storage temp. | -20°C | | form | Solid | | color | Brown to dark brown | | InChI | 1S/C12H7NO3/c14-7-1-3-9-11(5-7)16-12-6-8(15)2-4-10(12)13-9/h1-6,14H/i1D,2D,3D,4D,5D,6D | | InChIKey | HSSLDCABUXLXKM-MZWXYZOWSA-N | | SMILES | [2H]c1c([2H])c2N=C3C([2H])=C([2H])C(=O)C([2H])=C3Oc2c([2H])c1O | | CAS Number Unlabeled | 635-78-9 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | HS Code | 2845901000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Resorufin-[D6] Usage And Synthesis |
| Uses | Resorufin-d6 is the deuterium labeled Resorufin. Resorufin (NSC 12097) is a highly fluorescent pink dye for the detection of ROS/RNS and a second analyte[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110
[2] Odyniec ML , et al. 'AND'-based fluorescence scaffold for the detection of ROS/RNS and a second analyte. Chem Commun (Camb). 2018 Jul 26;54(61):8466-8469. DOI:10.1039/c8cc04316g |
| | Resorufin-[D6] Preparation Products And Raw materials |
|