|
|
| | 6-Chloro-4-hydroxy-2-methylquinoline Basic information |
| Product Name: | 6-Chloro-4-hydroxy-2-methylquinoline | | Synonyms: | 6-Chloro-2-methyl-4-quinolinol;2-Methyl-4-hydroxy-6-chloroquinoline;AURORA 18121;6-CHLORO-2-METHYLQUINOLIN-4(1H)-ONE;6-CHLORO-2-METHYLQUINOLIN-4-OL;6-CHLORO-2-METHYL-4(1H)QUINOLONE;6-CHLORO-4-HYDROXYQUINALDINE;4-Quinolinol, 6-chloro-2-methyl- | | CAS: | 15644-86-7 | | MF: | C10H8ClNO | | MW: | 193.63 | | EINECS: | | | Product Categories: | | | Mol File: | 15644-86-7.mol |  |
| | 6-Chloro-4-hydroxy-2-methylquinoline Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C10H8ClNO/c1-6-4-10(13)8-5-7(11)2-3-9(8)12-6/h2-5H,1H3,(H,12,13) | | InChIKey | VGDMRXDQWBBKBW-UHFFFAOYSA-N | | SMILES | ClC1=CC2=C(C=C1)N=C(C)C=C2O |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 6-Chloro-4-hydroxy-2-methylquinoline Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 71, p. 1906, 1949 DOI: 10.1021/ja01174a002 |
| | 6-Chloro-4-hydroxy-2-methylquinoline Preparation Products And Raw materials |
|