- 5-Chloronicotinic acid
-
- $1.10 / 1g
-
2025-11-18
- CAS:22620-27-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- 5-Chloronicotinic acid
-
- $0.00 / 25kg
-
2024-03-28
- CAS:22620-27-5
- Min. Order: 25kg
- Purity: 98%
- Supply Ability: Inquiry
|
| | 5-Chloronicotinic acid Basic information |
| | 5-Chloronicotinic acid Chemical Properties |
| Melting point | 169-171°C | | Boiling point | 303.7±22.0 °C(Predicted) | | density | 1.470±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder to crystal | | pka | 3.10±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C6H4ClNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10) | | InChIKey | XYLPLVUYPAPCML-UHFFFAOYSA-N | | SMILES | C1=NC=C(Cl)C=C1C(O)=O | | CAS DataBase Reference | 22620-27-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | 5-Chloronicotinic acid Usage And Synthesis |
| Chemical Properties | Off white powder | | Uses | 5-Chloronicotinic Acid is used as reagent/reactant luminescence and hydrothermal preparation of cobalt/cadmium/lead chloronicotinate phenanthroline MOF. |
| | 5-Chloronicotinic acid Preparation Products And Raw materials |
|