| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- Mal-amido-PEG4-acid
-
-
2025-06-07
- CAS:1263045-16-4
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Mal-Amido-PEG4-acid Basic information |
| Product Name: | Mal-Amido-PEG4-acid | | Synonyms: | Mal-CH2CH2CONH-PEG4-CH2CH2COOH;1-[3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamido]-3,6,9,12-tetraoxapentadecan-15-oic acid;19-Maleimido-17-oxo-4,7,10,13-tetraoxa-16-azanonadecanoic Acid;Maleimide-NH-PEG4-CH2CH2COOH;Maleimide-PEG4-propionic acid;MAL-AMIDO-PEG4-COOH;Mal-NH-PEG4-COOH;Mal-Amido-PEG4-acid | | CAS: | 1263045-16-4 | | MF: | C18H28N2O9 | | MW: | 416.42 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1263045-16-4.mol |  |
| | Mal-Amido-PEG4-acid Chemical Properties |
| Boiling point | 659.1±55.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | -20°C, protect from light | | solubility | Soluble in Water, DMSO, DMF, DCM | | form | powder to crystal | | pka | 4.28±0.10(Predicted) | | color | White to Gray to Brown | | InChI | InChI=1S/C18H28N2O9/c21-15(3-6-20-16(22)1-2-17(20)23)19-5-8-27-10-12-29-14-13-28-11-9-26-7-4-18(24)25/h1-2H,3-14H2,(H,19,21)(H,24,25) | | InChIKey | IAJVEYLYYHOZEY-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O | | CAS DataBase Reference | 1263045-16-4 |
| | Mal-Amido-PEG4-acid Usage And Synthesis |
| Description | Mal-amido-PEG4-acid is a PEG linker containing a maleimide group and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | Uses | Mal-amido-PEG4-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562. DOI:10.1016/j.ebiom.2018.09.005 |
| | Mal-Amido-PEG4-acid Preparation Products And Raw materials |
|