| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | dibenzo[b,d]furan-3-ylboronic acid Basic information |
| Product Name: | dibenzo[b,d]furan-3-ylboronic acid | | Synonyms: | Boronic acid, 3-dibenzofuranyl-;Boronic acid,B-3-dibenzofuranyl-;dibenzo[b,d]furan-3-ylboronic acid;B-3-dibenzofuranylBoronic acid;(3-Dibenzofuranyl)boronic acid;Dibenzofuran-3-boronic acid;Dibenzofuran-3-ylboronic acid;Dibenzo[b,d]furan-3-boronicacid | | CAS: | 395087-89-5 | | MF: | C12H9BO3 | | MW: | 212.01 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 395087-89-5.mol | ![dibenzo[b,d]furan-3-ylboronic acid Structure](CAS/20200119/GIF/395087-89-5.gif) |
| | dibenzo[b,d]furan-3-ylboronic acid Chemical Properties |
| Boiling point | 438.5±37.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.20±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H9BO3/c14-13(15)8-5-6-10-9-3-1-2-4-11(9)16-12(10)7-8/h1-7,14-15H | | InChIKey | FQENSZQWKVWYPA-UHFFFAOYSA-N | | SMILES | B(C1=CC=C2C3=CC=CC=C3OC2=C1)(O)O |
| | dibenzo[b,d]furan-3-ylboronic acid Usage And Synthesis |
| Uses | Dibenzo[b,d]furan-3-ylboronic acid can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development and chemical and pharmaceutical production processes. | | Synthesis | In a 300 ml three-necked flask, 7.2 g of 4-bromodibenzofuran was dissolved in 78° C. anhydrous tetrahydrofuran (THF) under an argon atmosphere. Then, 20 ml of an n-butyl lithium-n-hexane solution (1.6 M, 1.1 eq) was added and stirred for 1 hour. 4.23 ml (1.3 eq) of trimethoxyborane (B(OMe)3) was added and stirred for 2 hours, and the temperature of the reaction system was increased to room temperature. 200 ml of 1 N hydrochloric acid was added into the reactant and stirred for 3 hours. An organic layer was separated, and solvents were distilled off. In the crude product thus obtained, hexane was added. Precipitated product was filtered to obtain 4.94 g of dibenzofuran-4-boronic acid as a white solid (yield 80percent). The product was measured by FAB-MS, and dibenzofuran-4-boronic acid having a molecular weight of 212 was detected. |
| | dibenzo[b,d]furan-3-ylboronic acid Preparation Products And Raw materials |
|