|
|
| | Dibenzo[b,d]furan-2-ylboronic acid Basic information | | Application |
| | Dibenzo[b,d]furan-2-ylboronic acid Chemical Properties |
| Boiling point | 439℃ | | density | 1.34 | | Fp | 219℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.25±0.30(Predicted) | | form | powder | | color | White | | InChI | InChI=1S/C12H9BO3/c14-13(15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-7,14-15H | | InChIKey | DSSBJZCMMKRJTF-UHFFFAOYSA-N | | SMILES | B(C1=CC=C2C(=C1)C1=CC=CC=C1O2)(O)O |
| | Dibenzo[b,d]furan-2-ylboronic acid Usage And Synthesis |
| Application | Dibenzofuran-2-boronic acid is an important intermediate for novel organic electroluminescent materials, as well as an organic synthesis intermediate and a pharmaceutical intermediate. It can be used in laboratory research and development processes and chemical production processes. | | Chemical Properties | off-white powder |
| | Dibenzo[b,d]furan-2-ylboronic acid Preparation Products And Raw materials |
|