| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dibenzofuran-4-carboxaldehyde 97 Basic information |
| | Dibenzofuran-4-carboxaldehyde 97 Chemical Properties |
| Melting point | 94-98 °F(lit.) | | Boiling point | 360.5±15.0 °C(Predicted) | | density | 1.289±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Orange to Green | | InChI | 1S/C13H8O2/c14-8-9-4-3-6-11-10-5-1-2-7-12(10)15-13(9)11/h1-8H | | InChIKey | GQYTWBPRZFRASB-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cccc2c3ccccc3oc12 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids |
| | Dibenzofuran-4-carboxaldehyde 97 Usage And Synthesis |
| | Dibenzofuran-4-carboxaldehyde 97 Preparation Products And Raw materials |
|