| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
N-Boc-PEG4-bromide manufacturers
- Br-PEG4-NHBoc
-
-
2025-06-07
- CAS:1392499-32-9
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | N-Boc-PEG4-bromide Basic information |
| Product Name: | N-Boc-PEG4-bromide | | Synonyms: | N-Boc-PEG4-bromide;BocNH-PEG4-CH2CH2Br;N-Boc-PEG5-bromide;Br-PEG4-NHBoc;5,8,11,14-Tetraoxa-2-azahexadecanoic acid, 16-bromo-, 1,1-dimethylethyl ester;ADC,antibody-drug,PROTAC Linkers,ADC Linkers,N-Boc-PEG-5-bromide,cleavable,inhibit,conjugates,Inhibitor,N Boc PEG5 bromide,NBocPEG5bromide,Antibody-drug conjugates linkers;tert-butyl N-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate;N-Boc-PEG4-bromide N-Boc- | | CAS: | 1392499-32-9 | | MF: | C15H30BrNO6 | | MW: | 400.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1392499-32-9.mol |  |
| | N-Boc-PEG4-bromide Chemical Properties |
| Boiling point | 459.3±40.0 °C(Predicted) | | density | 1.223±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Soluble in DCM | | pka | 12.23±0.46(Predicted) | | form | Liquid | | color | Light yellow to brown | | InChI | InChI=1S/C15H30BrNO6/c1-15(2,3)23-14(18)17-5-7-20-9-11-22-13-12-21-10-8-19-6-4-16/h4-13H2,1-3H3,(H,17,18) | | InChIKey | KYOVSWOWVSWAII-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCOCCOCCBr |
| | N-Boc-PEG4-bromide Usage And Synthesis |
| Description | N-Boc-PEG4-bromide is a PEG linker containing a bromide group and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The bromide (Br) is a very good leaving group for nucleophilic substitution reactions. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Biological Activity | N-Boc-PEG5-bromide is a PROTAC linker that belongs to the PEG class and the Alkyl/ether class. It can be used to synthesize a series of PROTAC molecules. It is a cleavable ADC linker for the synthesis of antibody drug conjugates (ADCs). | | in vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. | | target | | Cleavable | PEGs | Alkyl/ether | |
| | N-Boc-PEG4-bromide Preparation Products And Raw materials |
|