| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-（0）57185586718 +86-13336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:3,5,7,8,3',4'-Hexahydroxyflavone
CAS:489-35-0
Purity:98%(min,HPLC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
- Gossypetin
-
- $129.00
-
2026-07-27
- CAS:489-35-0
- Purity: 95.00%
- Supply Ability: 10g
- GOSSYPETIN
-
- $249.00
-
2019-07-06
- CAS:489-35-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000kg
|
| | GOSSYPETIN Basic information |
| Product Name: | GOSSYPETIN | | Synonyms: | 3,3',4',5,7,8-Hexahydroxyflavone;8-Hydroxyquercetin;Articulatidin;C.I.75750;Equisporol;GOSSYPETIN(RG);2-(3,4-Dihydroxyphenyl)-3,5,7,8-tetrahydroxy-4H-1-benzopyran-4-one;3,5,7,3',4',8-HEXAHYDROXYFLAVONE | | CAS: | 489-35-0 | | MF: | C15H10O8 | | MW: | 318.24 | | EINECS: | | | Product Categories: | Flavanols | | Mol File: | 489-35-0.mol |  |
| | GOSSYPETIN Chemical Properties |
| Melting point | 302-304°C | | Boiling point | 679.3±55.0 °C(Predicted) | | density | 1.912 | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated)) | | form | Solid | | pka | 6.47±0.40(Predicted) | | color | Dark Yellow | | InChI | InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,16-20,22H | | InChIKey | YRRAGUMVDQQZIY-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C(O)=C2)OC2=C(O)C(O)=CC(O)=C2C(=O)C=1O | | LogP | 1.160 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | GOSSYPETIN Usage And Synthesis |
| Uses | 3,5,7,8,3'',4''-Hexahydroxyflavone is a flavonoid found in H. sabdariffa and has diverse biological activities/properties. 3,5,7,8,3'',4''-Hexahydroxyflavone is the anxiolytic and antidepressant constituents of H. sabdariffa calyces. | | Definition | ChEBI: Gossypetin is a hexahydroxyflavone having the hydroxy groups placed at the 3-, 3'-, 4'-, 5- 7- and 8-positions. It has a role as a plant metabolite. It is a 7-hydroxyflavonol and a hexahydroxyflavone. It is a conjugate acid of a gossypetin-3-olate and a gossypetin(1-). | | Biological Activity | Gossypetin is a hexahydroxylated flavonoid found in the flowers and the calyx of Hibiscus, which exhibits numerous pharmacological effects, including antioxidant, antibacterial and anticancer activities. It induces apoptosis and autophagic cell death in prostate cancer cells. Gossypetin is a potent inhibitor of MKK3 and MKK6 protein kinases th at suppresses esophageal cancer growth. |
| | GOSSYPETIN Preparation Products And Raw materials |
|