| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | (5-Bromothien-2-yl)methanol Basic information |
| Product Name: | (5-Bromothien-2-yl)methanol | | Synonyms: | RARECHEM AL BD 0180;(5-BROMOTHIOPHEN-2-YL)METHANOL;(5-Bromo-2-thienyl)methanol;5-BroMo-2-thiopheneMethanol, 95%;(5-bromo-2-thiophenyl)methanol;5-Bromo-2-thiophenemethanol >;2-Thiophenemethanol, 5-bromo-;2-Bromo-5-(hydroxymethyl)thiophene | | CAS: | 79387-71-6 | | MF: | C5H5BrOS | | MW: | 193.06 | | EINECS: | | | Product Categories: | | | Mol File: | 79387-71-6.mol |  |
| | (5-Bromothien-2-yl)methanol Chemical Properties |
| Boiling point | 267.1±25.0 °C(Predicted) | | density | 1.772±0.06 g/cm3(Predicted) | | refractive index | 1.6010 to 1.6050 | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | pka | 13.50±0.10(Predicted) | | form | Liquid | | color | Pale yellow | | λmax | 246nm(MeOH)(lit.) | | InChI | InChI=1S/C5H5BrOS/c6-5-2-1-4(3-7)8-5/h1-2,7H,3H2 | | InChIKey | DBRSLMCLMMFHEF-UHFFFAOYSA-N | | SMILES | C1(CO)SC(Br)=CC=1 | | CAS DataBase Reference | 79387-71-6 |
| | (5-Bromothien-2-yl)methanol Usage And Synthesis |
| | (5-Bromothien-2-yl)methanol Preparation Products And Raw materials |
|