|
|
| | 5-Bromo-2-thiophenecarboxylic acid Basic information |
| | 5-Bromo-2-thiophenecarboxylic acid Chemical Properties |
| Melting point | 140 °C | | Boiling point | 318.9±27.0 °C(Predicted) | | density | 1.923±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.32±0.10(Predicted) | | form | Crystalline Powder | | color | White to cream | | BRN | 118364 | | InChI | InChI=1S/C5H3BrO2S/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8) | | InChIKey | COWZPSUDTMGBAT-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC(Br)=CC=1 | | CAS DataBase Reference | 7311-63-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36/37/39-22-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 5-Bromo-2-thiophenecarboxylic acid Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powder | | Uses | A thiophene derivative with genotoxicity | | Uses | 5-Bromo-2-thiophenecarboxylic acid may be used in the preparation of:
- 5-bromo-2-thiophenecarboxylic acid butyl ester
- sulphonyl-tetrafluorophenyl (STP) esters
- new porphyrin sensitizers based on donor-Π-acceptor (D-Π-A) approach
| | Synthesis Reference(s) | Journal of Medicinal Chemistry, 35, p. 1109, 1992 DOI: 10.1021/jm00084a016 |
| | 5-Bromo-2-thiophenecarboxylic acid Preparation Products And Raw materials |
|