| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:L-Alanine-d7
CAS:74280-71-0
Remarks:CS-C-00089
|
| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:L-Alanine-d7
CAS:74280-71-0
Remarks:CS-C-00222
|
|
| | L-ALANINE (D7) Basic information |
| Product Name: | L-ALANINE (D7) | | Synonyms: | L-ALANINE (D7);L-ALANINE-D7 98 ATOM % D;L-Alanine-D2;Alanine-d7 >= 97 atom %D;L-ALANINE (D7) USP/EP/BP;L-alanine-d7 (9ci);L-Alanine-N,N,1,2,3,3,3-d7;L-Alanine-d7 | | CAS: | 74280-71-0 | | MF: | C3D7NO2 | | MW: | 96.14 | | EINECS: | | | Product Categories: | | | Mol File: | 74280-71-0.mol |  |
| | L-ALANINE (D7) Chemical Properties |
| Melting point | >300 °C(lit.) | | form | solid | | color | White to off-white | | InChI | 1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1D3,2D/hD3 | | InChIKey | QNAYBMKLOCPYGJ-VQIVFXRSSA-N | | SMILES | [2H]OC(=O)[C@@]([2H])(N([2H])[2H])C([2H])([2H])[2H] | | CAS DataBase Reference | 74280-71-0 | | CAS Number Unlabeled | 56-41-7 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-ALANINE (D7) Usage And Synthesis |
| Uses | L-Alanine-d7 (CAS# 74280-71-0) is a useful isotopically labeled research compound. |
| | L-ALANINE (D7) Preparation Products And Raw materials |
|