|
|
| | TRIS(4-FORMYLPHENYL)AMINE Basic information |
| Product Name: | TRIS(4-FORMYLPHENYL)AMINE | | Synonyms: | TRI-(4-FORMYLPHENYL)-AMINE;4,4μ,4-Nitrilotrisbenzaldehyde, 4,4μ,4-Triformyltriphenylamine;4,4′,4″-Nitrilotrisbenzaldehyde;4,4′,4″-Triformyltriphenylamine;TRIS(4-FORMYLPHENYL)AMINE;Tris(4-formylphenyl)amine 97%;4,4′,4″-Trifor;4-[bis(4-formylphenyl)amino]benzaldehyde | | CAS: | 119001-43-3 | | MF: | C21H15NO3 | | MW: | 329.35 | | EINECS: | | | Product Categories: | | | Mol File: | 119001-43-3.mol |  |
| | TRIS(4-FORMYLPHENYL)AMINE Chemical Properties |
| Melting point | 244-248 °C | | Boiling point | 551.1±45.0 °C(Predicted) | | density | 1.288±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Chloroform | | form | powder to crystal | | pka | -10.76±0.50(Predicted) | | color | Light yellow to Yellow to Green | | InChI | InChI=1S/C21H15NO3/c23-13-16-1-7-19(8-2-16)22(20-9-3-17(14-24)4-10-20)21-11-5-18(15-25)6-12-21/h1-15H | | InChIKey | YOXHQRNDWBRUOL-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(C=C1)C=O)(C1=CC=C(C=C1)C=O)C1=CC=C(C=C1)C=O | | CAS DataBase Reference | 119001-43-3 |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 29223990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Skin Sens. 1 |
| | TRIS(4-FORMYLPHENYL)AMINE Usage And Synthesis |
| Chemical Properties | Pale yellow powder | | Uses | Used in preparation of triangular ligands for self-assembly into M4L4 tetrahedra. |
| | TRIS(4-FORMYLPHENYL)AMINE Preparation Products And Raw materials |
|