|
|
| | 4-CHLORO-2-METHYLBENZOIC ACID Basic information |
| | 4-CHLORO-2-METHYLBENZOIC ACID Chemical Properties |
| Melting point | 167-171 °C (lit.) | | Boiling point | 300.3±22.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.63±0.25(Predicted) | | color | White | | InChI | InChI=1S/C8H7ClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | XXFKOBGFMUIWDH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Cl)C=C1C | | CAS DataBase Reference | 7499-07-2(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-41 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-CHLORO-2-METHYLBENZOIC ACID Usage And Synthesis |
| Chemical Properties | White to yellow powder or crystal | | Uses | 4-Chloro-2-methylbenzoic acid can be used in the synthesis of:
- 4-chloro-2-methylbenzophenone via Freidel Craft′s acylation with benzene
- 4-chloro-2-methyl-5-(methylsulfonyl)benzoic acid
- 4-chloro-2-methyl-3-nitrobenzoic acid methyl ester
| | General Description | 4-Chloro-2-methylbenzoic acid can be synthesized from 4-chlorobenzoic acid via a multi-step reaction process. |
| | 4-CHLORO-2-METHYLBENZOIC ACID Preparation Products And Raw materials |
|