|
|
| | N-Boc-3,4-dihydro-2H-pyridine Basic information |
| Product Name: | N-Boc-3,4-dihydro-2H-pyridine | | Synonyms: | 1-N-BOC-3,4-DIHYDRO-2H-PYRIDINE;3,4-DIHYDRO-2H-PYRIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;tert-Butyl 3,4-dihydropyridine-1(2H)-carboxylate;REF DUPL: 1-N-Boc-3,4-dihydro-2H-pyridine;N-Boc-3,4-dihydro-2H-pyridine 97%;1(2H)-Pyridinecarboxylic acid, 3,4-dihydro-, 1,1-dimethylethyl ester;tert-butyl 3,4-dihydro-2H-pyridine-1-carboxylate;tert-Butyl 3,4-dihydro-1(2H)-pyridinecarboxylate | | CAS: | 131667-57-7 | | MF: | C10H17NO2 | | MW: | 183.25 | | EINECS: | | | Product Categories: | | | Mol File: | 131667-57-7.mol |  |
| | N-Boc-3,4-dihydro-2H-pyridine Chemical Properties |
| Boiling point | 254 °C | | density | 0.988 g/mL at 25 °C | | refractive index | n20/D1.477 | | Fp | 107 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | pka | -0.56±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C10H17NO2/c1-10(2,3)13-9(12)11-7-5-4-6-8-11/h5,7H,4,6,8H2,1-3H3 | | InChIKey | VIBQTJLMJANION-UHFFFAOYSA-N | | SMILES | C1N(C(OC(C)(C)C)=O)C=CCC1 |
| Hazard Codes | T,N | | Risk Statements | 25-50 | | Safety Statements | 45-61 | | RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |
| | N-Boc-3,4-dihydro-2H-pyridine Usage And Synthesis |
| | N-Boc-3,4-dihydro-2H-pyridine Preparation Products And Raw materials |
|