|
|
| | (E)-Methyl 4-coumarate Basic information |
| | (E)-Methyl 4-coumarate Chemical Properties |
| Melting point | 138-140°C | | Boiling point | 306.6±17.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.82±0.13(Predicted) | | color | Off-White to Beige | | λmax | 315nm(MeOH)(lit.) | | Cosmetics Ingredients Functions | VISCOSITY CONTROLLING
SKIN CONDITIONING - EMOLLIENT
SKIN CONDITIONING | | InChI | 1S/C10H10O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7,11H,1H3/b7-4+ | | InChIKey | NITWSHWHQAQBAW-QPJJXVBHSA-N | | SMILES | O=C(OC)/C=C/C1=CC=C(O)C=C1 | | CAS DataBase Reference | 19367-38-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2916.39.7900 | | Storage Class | 11 - Combustible Solids |
| | (E)-Methyl 4-coumarate Usage And Synthesis |
| Chemical Properties | Off-White to Pale Orange Solid | | Uses | Cinnamic acid derivative used in structure-antifungal activity relationship study against Aspergillus flavus, Aspergillus terreus, and Aspergillus niger. An antifungal agent. | | Uses | Methyl 4-hydroxycinnamate is an antifungal agent,it is used in structure-antifungal activity relationship study against Aspergillus flavus, Aspergillus terreus, and Aspergillus niger. | | Definition | ChEBI: 4-coumaric acid methyl ester is a cinnamate ester that is the methyl ester of 4-coumaric acid. It has a role as a melanin synthesis inhibitor, a fungal metabolite, an anti-inflammatory agent, an antifungal agent and a plant metabolite. It is a cinnamate ester, a member of phenols and a methyl ester. It is functionally related to a 4-coumaric acid. |
| | (E)-Methyl 4-coumarate Preparation Products And Raw materials |
|