| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N-Boc-(S)-1-amino-2-propanol Basic information |
| Product Name: | N-Boc-(S)-1-amino-2-propanol | | Synonyms: | BOC-(S)-(+)-1-AMINO-2-PROPANOL;BOC-(S)-1-AMINO-2-PROPANOL;N-T-BOC-(S)-1-AMINO-2-PROPANOL;Carbamic acid, [(2S)-2-hydroxypropyl]-, 1,1-dimethylethyl ester (9CI);(S)-1-(Boc-amino)-2-propanol, 97%;(S)-tert-Butyl (2-hydroxypropyl)carbamate;N-Boc-(S)-2-hydroxypropanamine;tert-butyl [(2S)-2-hydroxypropyl]carbamate | | CAS: | 167938-56-9 | | MF: | C8H17NO3 | | MW: | 175.23 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 167938-56-9.mol |  |
| | N-Boc-(S)-1-amino-2-propanol Chemical Properties |
| Boiling point | 276.4±23.0 °C(Predicted) | | density | 1.025±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.42±0.46(Predicted) | | form | liquid | | color | Colourless | | Optical Rotation | Consistent with structure | | CAS DataBase Reference | 167938-56-9 |
| | N-Boc-(S)-1-amino-2-propanol Usage And Synthesis |
| Chemical Properties | Clear and colorless liquid | | Uses | (S)-1-(Boc-amino)-2-propanol is used as pharmaceutical intermediate. |
| | N-Boc-(S)-1-amino-2-propanol Preparation Products And Raw materials |
|