| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-(tert-Butoxycarbonyl)-O-benzyl-D-threonine Basic information |
| | N-(tert-Butoxycarbonyl)-O-benzyl-D-threonine Chemical Properties |
| Melting point | 110-117°C | | Boiling point | 461.5±45.0 °C(Predicted) | | density | 1.152±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | pka | 3.50±0.10(Predicted) | | color | White to off-white | | Optical Rotation | -20.2° (C=1.00 g/100ml ETOH) | | BRN | 7339503 | | Major Application | peptide synthesis | | InChI | 1S/C16H23NO5/c1-11(21-10-12-8-6-5-7-9-12)13(14(18)19)17-15(20)22-16(2,3)4/h5-9,11,13H,10H2,1-4H3,(H,17,20)(H,18,19) | | InChIKey | CTXPLTPDOISPTE-WCQYABFASA-N | | SMILES | N(C(C(OCc1ccccc1)C)C(=O)O)C(=O)OC(C)(C)C | | CAS DataBase Reference | 69355-99-3(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | N-(tert-Butoxycarbonyl)-O-benzyl-D-threonine Usage And Synthesis |
| Uses | Boc-D-Thr(Bzl)-OH, is an amino acid derivative that can be used in the synthesis of millepachine amino acid prodrugs with enhanced solubility as antitumor agents. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-(tert-Butoxycarbonyl)-O-benzyl-D-threonine Preparation Products And Raw materials |
|