| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- D-Homophe-Oet.HCl
-
-
2026-09-11
- CAS:90940-54-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | D-Homophenylalanine ethyl ester hydroc& Basic information | | Uses |
| Product Name: | D-Homophenylalanine ethyl ester hydroc& | | Synonyms: | D-Homophenylalanine ethyl ester hydrochloride, BR;(?)-Ethyl (R)-2-Amino-4-phenylbutyrate hydrochloride;D-HOMOPHENYLALANIN-ETHYLESTER-HYDROCHLOR;D-homophenylalanineethylesterHCl;D-Homophenylalanine ethyl ester hydrochloride;(R)-ethyl 2-aMino-4-phenylbutanoate hydrochloride;Benzenebutanoic acid, a-aMino-, ethyl ester,hydrochloride (1:1), (aR)-;D-HoMophenylalanine ethyl ester Hydrcohloride | | CAS: | 90940-54-8 | | MF: | C12H17NO2.ClH | | MW: | 243.73 | | EINECS: | | | Product Categories: | | | Mol File: | 90940-54-8.mol |  |
| | D-Homophenylalanine ethyl ester hydroc& Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | color | White to off-white | | Optical Rotation | [α]/D -38.0±2.0°, c = 1 in H2O | | BRN | 8937583 | | InChI | InChI=1/C12H17NO2.ClH/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10;/h3-7,11H,2,8-9,13H2,1H3;1H/t11-;/s3 | | InChIKey | PTFKZMFFSIYCOV-XAAIUDFWNA-N | | SMILES | C(C1C=CC=CC=1)C[C@@H](N)C(=O)OCC.Cl |&1:8,r| |
| | D-Homophenylalanine ethyl ester hydroc& Usage And Synthesis |
| Uses | D-Homophenylalanine Ethyl Ester Hydrochloride is a useful research chemical. | | Uses | D-Homophenylalanine ethyl ester hydrochloride may be used to synthesize (R)-2-amino-4-phenylbutan-1-ol, an intermediate for 2,6-bis[(4R)-4,5-dihydro-4-(2-phenylethyl)-2-oxazolyl]pyridine ligand. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | D-Homophenylalanine ethyl ester hydroc& Preparation Products And Raw materials |
|