- L-Homophe-Oet.Hcl
-
- $0.00 / 1kg
-
2026-03-31
- CAS:90891-21-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Homophenylalanine ethyl ester hydrochloride Basic information |
| | L-Homophenylalanine ethyl ester hydrochloride Chemical Properties |
| Melting point | 159-163 °C(lit.) | | alpha | 26 º (c=1,CHCl3) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Powder | | color | White to off-white to tan | | Optical Rotation | [α]20/D +26°, c = 1 in chloroform | | Major Application | peptide synthesis | | InChI | 1S/C12H17NO2.ClH/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10;/h3-7,11H,2,8-9,13H2,1H3;1H/t11-;/m0./s1 | | InChIKey | PTFKZMFFSIYCOV-MERQFXBCSA-N | | SMILES | Cl[H].CCOC(=O)[C@@H](N)CCc1ccccc1 | | CAS DataBase Reference | 90891-21-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | L-Homophenylalanine ethyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | L-Homophenylalanine Ethyl Ester Hydrochloride is used to prepare optically active (-)-(amino)tetrahydrobenzazepinone . | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Homophenylalanine ethyl ester hydrochloride Preparation Products And Raw materials |
|