| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Phenol-d6
-
- $9.00
-
2026-05-28
- CAS:13127-88-3
- Min. Order: 1KG
- Purity: 99.8%
- Supply Ability: 100tons
- Phenol-D6
-
-
2026-05-11
- CAS:13127-88-3
- Purity:
- Supply Ability: 10g
|
| Product Name: | Phenol-d6 | | Synonyms: | hexadeuterophenol;PHENOL-D6(SUR);Phenol-d6, 98+ atom % d, for NMR;Phenol-d6,for NMR,98+ atom % D;Hexadeuteriophenol;Phen-2,3,4,5,6-d5-ol-d;PHENOL-D6 DEUTERATION DEGREE MIN. 98%;Phen-2,3,4,5,6-d5-ol-d | | CAS: | 13127-88-3 | | MF: | C6D6O | | MW: | 100.15 | | EINECS: | 236-063-8 | | Product Categories: | 600 Series Wastewater Methods;EPA;Method 625 | | Mol File: | 13127-88-3.mol |  |
| | Phenol-d6 Chemical Properties |
| Melting point | 40-42 °C (lit.) | | Boiling point | 182 °C (lit.) | | density | 1.140 g/mL at 25 °C | | vapor density | 3.24 (vs air) | | vapor pressure | 0.36 mm Hg ( 20 °C) | | Fp | 175 °F | | storage temp. | 2-8°C | | solubility | 84g/l | | form | Solid Mass (Deliquescent) | | PH | 5 (50g/l, H2O, 20℃) | | explosive limit | 1.3-9.5%(V) | | BRN | 2255089 | | Stability: | Stable. Incompatible with strong acids, strong bases, strong oxidizing agents. | | InChI | 1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H/i1D,2D,3D,4D,5D/hD | | InChIKey | ISWSIDIOOBJBQZ-QNKSCLMFSA-N | | SMILES | [2H]Oc1c([2H])c([2H])c([2H])c([2H])c1[2H] | | CAS DataBase Reference | 13127-88-3(CAS DataBase Reference) | | EPA Substance Registry System | Phenol-d6 (13127-88-3) | | CAS Number Unlabeled | 108-95-2 |
| Hazard Codes | T,C,Xn | | Risk Statements | 23/24/25-34-48/20/21/22-68-40 | | Safety Statements | 24/25-26-28-36/37/39-45-36/37 | | RIDADR | UN 1671 6.1/PG 2 | | WGK Germany | 2 | | F | 3-8-10-23 | | Autoignition Temperature | 1319 °F | | HazardClass | 6.1(a) | | PackingGroup | II | | HS Code | 28459000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 2
Eye Dam. 1
Muta. 2
Skin Corr. 1B
STOT RE 2 |
| | Phenol-d6 Usage And Synthesis |
| Synthesis | 
Yamamoto et al. reported that phenol-D6 can be obtained by reacting phenol with heavy water under PtO2 catalysis at 250°C and 4 MPa. | | Chemical Properties | solid | | Uses | Phenol is purified here for molecular genetics applications. It is naturally found in tea leaves and plants, and has uses in the synthesis of antioxidant compounds due to the antioxidant activity caus
ed by the phenol moiety. This structure also allows it to be used for syntheses of anti-bacterial & anti-carcinogenic compounds. This is the labelled analog. |
| | Phenol-d6 Preparation Products And Raw materials |
|