β-Nicotinamide adenine dinucleotide reduced dipotassium manufacturers
|
| | β-Nicotinamide adenine dinucleotide reduced dipotassium Basic information |
| Product Name: | β-Nicotinamide adenine dinucleotide reduced dipotassium | | Synonyms: | NADH DIPOTASSIUM SALT;BETA-DPNH DIPOTASSIUM SALT;BETA-NADH DIPOTASSIUM SALT;BETA-NICOTINAMIDE ADENINE DINUCLEOTIDE, REDUCED FORM DIPOTASSIUM SALT;DPNH DIPOTASSIUM SALT;DIPHOSPHOPYRIDINE NUCLEOTIDE, REDUCED FORM DIPOTASSIUM SALT;β-nicotinamide adenine dinucleotide, reduced dipotassium salt;β-DPNH, β-NADH, Diphosphopyridine nucleotide, reduced form, DPNH, NADH | | CAS: | 104809-32-7 | | MF: | C21H27K2N7O14P2 | | MW: | 741.62 | | EINECS: | | | Product Categories: | | | Mol File: | 104809-32-7.mol |  |
| | β-Nicotinamide adenine dinucleotide reduced dipotassium Chemical Properties |
| storage temp. | -20°C | | solubility | 10 mM NaOH: soluble-100mg/mL, clear to hazy, faintly yellow to yellow | | form | powder | | biological source | synthetic | | InChIKey | UMJWDCRRGAZCFU-LRANKJFRNA-L | | SMILES | [K].NC(=O)C1=CN(C=CC1)C2OC(COP(O)(=O)OP(O)(=O)OCC3OC(C(O)C3O)n4cnc5c(N)ncnc45)C(O)C2O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-36/37/39 | | WGK Germany | - | | Storage Class | 11 - Combustible Solids |
| | β-Nicotinamide adenine dinucleotide reduced dipotassium Usage And Synthesis |
| Description | β-nicotinamide adenine dinucleotide reduced dipotassium is a reducing coenzyme with oral activity. β-nicotinamide adenine dinucleotide reduced dipotassium is the ADP-ribose unit donor in the ADP-ribosidic acid reaction and the precursor of cyclic ADP-ribose. β-nicotinamide adenine dinucleotide reduction dipotassium plays a role in regenerating electron donors in cellular energy metabolism, including glycolysis, β oxidation, and tricarboxylic acid (TCA) cycle. | | Uses | β-Nicotinamide adenine dinucleotide reduced dipotassium is an orally active reduced coenzyme. β-Nicotinamide adenine dinucleotide reduced dipotassium is a donor of ADP-ribose units in ADP-ribosylaton reactions and a precursor of cyclic ADP-ribose. β-Nicotinamide adenine dinucleotide reduced dipotassium plays a role as a regenerative electron donor in cellular energy metabolism, including glycolysis, β-oxidation and the tricarboxylic acid (TCA) cycle[1]. | | Biochem/physiol Actions | Electron donor | | References | [1] Ying W. NAD+ and NADH in cellular functions and cell death. Front Biosci. 2006 Sep 1;11:3129-48. DOI:10.2741/2038 |
| | β-Nicotinamide adenine dinucleotide reduced dipotassium Preparation Products And Raw materials |
|