BETA-DPN LITHIUM SALT manufacturers
- BETA-DPN LITHIUM SALT
-
- $0.00 / 25KG
-
2025-12-01
- CAS:64417-72-7
- Min. Order: 1KG
- Purity: 98
- Supply Ability: 10000KGS
|
| | BETA-DPN LITHIUM SALT Basic information |
| Product Name: | BETA-DPN LITHIUM SALT | | Synonyms: | NICOTINIC ACID AMIDE ADENINE DINUCLEOTIDE;NAD, LI;NAD LITHIUM SALT;NAD+, LITHIUM SALT;NADIDE;NADIDE LITHIUM SALT;N A D, OXIDIZED FORM;NAD, OXIDIZED FORM, LITHIUM | | CAS: | 64417-72-7 | | MF: | C21H28LiN7O14P2 | | MW: | 671.38 | | EINECS: | 264-884-1 | | Product Categories: | nucleoside | | Mol File: | 64417-72-7.mol |  |
| | BETA-DPN LITHIUM SALT Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 50 mg/mL | | form | solid | | color | white | | biological source | rabbit | | Water Solubility | water: soluble | | InChIKey | KBNFBQPUEMBPKD-LRANKJFRNA-N | | SMILES | [Li].NC(=O)C1=CC=C[N](=C1)C2OC(COP(O)(=O)OP(O)(=O)OCC3OC(C(O)C3O)n4cnc5c(N)ncnc45)C(O)C2O |
| Hazard Codes | Xn | | Risk Statements | 36 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | UU3450000 | | Storage Class | 11 - Combustible Solids |
| | BETA-DPN LITHIUM SALT Usage And Synthesis |
| Uses | β-Nicotinamide adenine dinucleotide (NAD+) and β-Nicotinamide adenine dinucleotide, reduced (NADH) comprise a coenzyme redox pair (NAD+:NADH) involved in a wide range of enzyme catalyzed oxidation reduction reactions. In addition to its redox function, NAD+/NADH is a donor of ADP-ribose units in ADP-ribosylaton (ADP-ribosyltransferases; poly(ADP-ribose) polymerases ) reactions and a precursor of cyclic ADP-ribose (ADP-ribosyl cyclases). | | Biochem/physiol Actions | Electron acceptor |
| | BETA-DPN LITHIUM SALT Preparation Products And Raw materials |
|