| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Calix[6]arene manufacturers
- CALIX[6]ARENE
-
-
2026-03-20
- CAS:96107-95-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
|
| | Calix[6]arene Basic information |
| | Calix[6]arene Chemical Properties |
| Melting point | 395 °C(lit.) | | Boiling point | 630.34°C (rough estimate) | | density | 1.302 | | refractive index | 1.6000 (estimate) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 9.20±0.20(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | 0.180g/100g of water @ 25°C. Miscible with alcohol, chloroform, ether, carbon disulfide, acetone, oils, carbon tetrachloride and glacial acetic acid. | | BRN | 4345238 | | InChIKey | JLSWUKWFQCVKCL-UHFFFAOYSA-N | | SMILES | C12=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)C2 | | CAS DataBase Reference | 96107-95-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2907.29.9000 | | Storage Class | 11 - Combustible Solids |
| | Calix[6]arene Usage And Synthesis |
| Chemical Properties | white to beige powder | | Uses | It is used as a starting material for preparing functionalized calixarenes. It finds its uses as a pharmaceutical intermediate. It is also used in complexation and organic synthesis. |
| | Calix[6]arene Preparation Products And Raw materials |
|