- Nitrophenide
-
- $30.00
-
2026-07-04
- CAS:537-91-7
- Purity: 99.78%
- Supply Ability: 10g
|
| | Bis(3-nitrophenyl) disulfide Basic information |
| | Bis(3-nitrophenyl) disulfide Chemical Properties |
| Melting point | 78-80 °C(lit.) | | Boiling point | 443.6±30.0 °C(Predicted) | | density | 1.5285 (rough estimate) | | refractive index | 1.6510 (estimate) | | solubility | soluble in Tetrahydrofuran | | form | powder to crystal | | color | Light yellow to Brown to Dark green | | Sensitive | Stench | | Merck | 14,6618 | | InChI | InChI=1S/C12H8N2O4S2/c15-13(16)9-3-1-5-11(7-9)19-20-12-6-2-4-10(8-12)14(17)18/h1-8H | | InChIKey | ODOFDWDUSSFUMN-UHFFFAOYSA-N | | SMILES | S(C1=CC=CC([N+]([O-])=O)=C1)SC1=CC=CC([N+]([O-])=O)=C1 | | CAS DataBase Reference | 537-91-7(CAS DataBase Reference) | | EPA Substance Registry System | Disulfide, bis(3-nitrophenyl) (537-91-7) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61-24/25 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | RTECS | JO1550000 | | Hazard Note | Harmful/Stench | | TSCA | TSCA listed | | HS Code | 29309090 |
| | Bis(3-nitrophenyl) disulfide Usage And Synthesis |
| Uses | 3-Nitrophenyl disulfide (Bis(3-Nitrophenyl) disulfide) is an inhibitor of mannitol-1-phosphate dehydrogenase (M1PDH) with IC50 of 3 μM. 3-Nitrophenyl disulfide has antiparasitic activity[1]. | | References | [1] Allocco JJ, et al. Nitrophenide (Megasul) blocks Eimeria tenella development by inhibiting the mannitol cycle enzyme mannitol-1-phosphate dehydrogenase. J Parasitol. 2001 Dec;87(6):1441-8. DOI:10.1645/0022-3395(2001)087[1441:NMBETD]2.0.CO;2 |
| | Bis(3-nitrophenyl) disulfide Preparation Products And Raw materials |
|