| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Nitrophenylsulfur pentafluoride Basic information |
| | 3-Nitrophenylsulfur pentafluoride Chemical Properties |
| Melting point | 0℃ | | Boiling point | 106 °C2 mm Hg(lit.) | | density | 1.665 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.475(lit.) | | Fp | >230 °F | | form | clear liquid | | color | Light yellow to Yellow to Orange | | Water Solubility | Difficult to mix in water. | | BRN | 2699206 | | InChI | InChI=1S/C6H4F5NO2S/c7-15(8,9,10,11)6-3-1-2-5(4-6)12(13)14/h1-4H | | InChIKey | FSTNQYCPXJMFMT-UHFFFAOYSA-N | | SMILES | S(C1C=CC=C(N(=O)=O)C=1)(F)(F)(F)(F)F | | CAS DataBase Reference | 2613-26-5(CAS DataBase Reference) |
| Hazard Codes | Xi,T,Xn | | Risk Statements | 34-36/37-20/22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Toxic/Irritant | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 STOT SE 3 |
| | 3-Nitrophenylsulfur pentafluoride Usage And Synthesis |
| Chemical Properties | Colorless to tan liquid | | Uses | It has a wide range of applications as a fluorinating agent. g. It is a convenient alternative to current fluorinating agents for use in the synthesis of specialty chemicals and intermediates, such as pharmaceuticals, agrochemicals and electronics chemicals. |
| | 3-Nitrophenylsulfur pentafluoride Preparation Products And Raw materials |
|