|
|
| | ISOPROPYL P-TOLUENESULFONATE Basic information |
| Product Name: | ISOPROPYL P-TOLUENESULFONATE | | Synonyms: | ISOPROPYL P-TOLUENESULFONATE;ISOPROPYL 4-TOLUENESULPHONATE;(4-methylphenyl) propane-2-sulfonate;propane-2-sulfonic acid (4-methylphenyl) ester;Isopropyl 4-methylbenzenesulphonate, Prop-2-yl 4-methylbenzenesulphonate;2-Propyl tosylate;Isopropyl p-Methylbenzenesulfonate;Isopropyl p-Tosylate | | CAS: | 2307-69-9 | | MF: | C10H14O3S | | MW: | 214.28 | | EINECS: | 218-989-4 | | Product Categories: | | | Mol File: | 2307-69-9.mol |  |
| | ISOPROPYL P-TOLUENESULFONATE Chemical Properties |
| Melting point | 20 | | Boiling point | 107-109 °C(Press: 0.4 Torr) | | density | 1.142 g/mL at 25 °C | | refractive index | n20/D1.503 | | Fp | 110 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C10H14O3S/c1-8(2)13-14(11,12)10-6-4-9(3)5-7-10/h4-8H,1-3H3 | | InChIKey | SDQCGKJCBWXRMK-UHFFFAOYSA-N | | SMILES | C1(S(OC(C)C)(=O)=O)=CC=C(C)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29041000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | ISOPROPYL P-TOLUENESULFONATE Usage And Synthesis |
| Uses | Isopropyl p-Tosylate is a sulfonic acid ester, a potentialy alkylating agent. Studies suggest Isopropyl p-Tosylate may exert genotoxic effects in bacterial and mammalian cell systems. | | Synthesis | The general procedure for the synthesis of isopropyl p-toluenesulfonate from sodium p-toluenesulfinate and isopropanol is as follows: to a solvent mixture containing dichloromethane (0.5 mL) and ethanol (0.5 mL) at room temperature, iodobenzene diacetate (DIB, 0.24 mmol, 1.2 eq.), sodium p-toluenesulfinate (0.2 mmol, 1 eq.), and acetic acid ( 0.01 g, 0.05 mL) or tetrabutylammonium chloride (TBAC, 55.5 mg, 0.2 mmol, 2 equiv) to dissolve the sulfonate. The reaction mixture was reacted under vigorous stirring for 15 minutes and subsequently monitored by thin layer chromatography (TLC) using a solvent mixture of acetic acid/ethyl acetate/hexane. Upon completion of the reaction, the mixture was filtered through silica gel and washed with ethyl acetate. Ultimately, the residue was purified by silica gel column chromatography using a mixed solvent of ethyl acetate/hexane to give the target product isopropyl p-toluenesulfonate (products 4, 6 and 8). | | References | [1] Beilstein Journal of Organic Chemistry, 2018, vol. 14, p. 1203 - 1207 |
| | ISOPROPYL P-TOLUENESULFONATE Preparation Products And Raw materials |
|