- Fmoc-D-Ser-OH
-
-
2026-08-21
- CAS:116861-26-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- FMOC-D-SER-OH
-
- $15.00
-
2021-08-12
- CAS:116861-26-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| | FMOC-D-SER-OH Basic information |
| | FMOC-D-SER-OH Chemical Properties |
| Melting point | 108-112 °C | | Boiling point | 599.3±50.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | refractive index | 11.0 ° (C=1, DMF) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder to crystal | | pka | 3.51±0.10(Predicted) | | color | White to Light yellow | | Major Application | peptide synthesis | | InChI | 1S/C18H17NO5/c20-9-16(17(21)22)19-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20H,9-10H2,(H,19,23)(H,21,22)/t16-/m1/s1 | | InChIKey | JZTKZVJMSCONAK-MRXNPFEDSA-N | | SMILES | N([C@H](CO)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 | | CAS DataBase Reference | 116861-26-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-SER-OH Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | N-Fmoc-D-serine is an N-Fmoc-protected form of D-Serine (S270975). D-Serine is a neurotransmitter that is concentrated in the mammalian brain, and is one of the very few amino acids that occur in the D- and L-configurations in significant amounts. D-Serine is an potent agonist of the N-methyl-D-aspartate (NMDA) receptor in the brain, which is associated with schizophrenia. Use of D-Serine has been considered as an additional therapy for refractory schizophrenic patients. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-SER-OH Preparation Products And Raw materials |
|