|
|
| | 4-(Trifluoromethyl)pyridine-2-carboxylic acid Basic information |
| | 4-(Trifluoromethyl)pyridine-2-carboxylic acid Chemical Properties |
| Melting point | 159-161°C | | Boiling point | 293.6±40.0 °C(Predicted) | | density | 1.484±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | fine crystalline powder | | pka | 3.21±0.10(Predicted) | | color | Faint lemon (hint of cream) | | InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)4-1-2-11-5(3-4)6(12)13/h1-3H,(H,12,13) | | InChIKey | BPRWTROIQXSSOC-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC=CC(C(F)(F)F)=C1 |
| | 4-(Trifluoromethyl)pyridine-2-carboxylic acid Usage And Synthesis |
| Description |
Pyridine-2-carboxylic acid (picolinic acid) has been extensively studied due to its magnetic, structural, medicinal and biological properties. Picolinic acid plays a vital role in the absorption of zinc and has neuro-protective, immunological and antiproliferative effects within the body. The multifunctional ligands containing N and O-donors, such as picolinic acid, are of great interest since they are significant from the industrial point of view. 4-(Trifluoromethyl)pyridine-2-carboxylic acid, a derivative of picolinic acid, could be used to synthesise a new polymeric copper(II) complex as a ligand[1].
| | References | [1] Hatice Vural, Metin Orbay. “Synthesis, crystal structure, spectroscopic investigations and DFT calculations of the copper(II) complex of 4-(Trifluoromethyl)pyridine-2-carboxylic acid.” Journal of Molecular Structure 1146 (2017): Pages 669-676.
|
| | 4-(Trifluoromethyl)pyridine-2-carboxylic acid Preparation Products And Raw materials |
|