|
|
| | 5-(Trifluoromethyl)pyridine-2-carboxylic acid Basic information |
| | 5-(Trifluoromethyl)pyridine-2-carboxylic acid Chemical Properties |
| Melting point | 135-137°C | | Boiling point | 273.7±40.0 °C(Predicted) | | density | 1.484±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | pka | 3.13±0.10(Predicted) | | color | Pale brown | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)4-1-2-5(6(12)13)11-3-4/h1-3H,(H,12,13) | | InChIKey | NJHGVAYLDHROPT-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 80194-69-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-(Trifluoromethyl)pyridine-2-carboxylic acid Usage And Synthesis |
| Uses | 5-(Trifluoromethyl)pyridine-2-carboxylic acid is an intermediate used in the synthesis of β-secretase (BACE) inhibitors. | | Uses | 5-(Trifluoromethyl)pyridine-2-carboxylic acid is an intermediate used in the synthesis of β-secretase (BACE) inhibitors. |
| | 5-(Trifluoromethyl)pyridine-2-carboxylic acid Preparation Products And Raw materials |
|