| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-4-CHLORO-ALPHA-METHYLBENZYL ALCOHOL Chemical Properties |
| alpha | 49 º (C=1.6 IN CHLOROFORM) | | Boiling point | 240.6±15.0 °C(Predicted) | | density | 1.158 g/mL at 25 °C | | refractive index | n20/D 1.544 | | Fp | 110 °C | | storage temp. | 2-8°C | | form | liquid | | pka | 14.22±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]20/D +49.0°, c = 1.6 in chloroform | | InChI | InChI=1/C8H9ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 | | InChIKey | MVOSNPUNXINWAD-ISZMHOAENA-N | | SMILES | C1([C@@H](C)O)C=CC(=CC=1)Cl |&1:1,r| |
| Hazard Codes | Xn | | Risk Statements | 22-41-52/53 | | Safety Statements | 26-39-61 | | WGK Germany | 3 | | HS Code | 2906290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | (R)-4-CHLORO-ALPHA-METHYLBENZYL ALCOHOL Usage And Synthesis |
| Preparation | (R)-4-CHLORO-ALPHA-METHYLBENZYL ALCOHOL can be used as: as a substrate in the racemization of secondary alcohols using ruthenium hydroxide complexes; in the synthesis of 2,3,4,9-tetrahydro-1H-carbazole as an effective DP1 antagonist; and as a substrate for the synthesis of chiral 3-aryl-3-substituted propionic acids via the Mitsunobu reaction. | | Uses | (R)-1-(4-Chlorophenyl)ethanol is a useful research chemical. | | Uses | (R)-4-Chloro-α-methylbenzyl alcohol can be used:
- As a substrate in the racemization process of secondary alcohols using ruthenium hydroxide complexes.
- In the synthesis of 2,3,4,9-tetrahydro-1H-carbazole as potent DP1 antagonists.
- As a substrate in the synthesis of chiral 3-aryl-3-substituted propanoic acids through Mitsunobu reaction.
|
| | (R)-4-CHLORO-ALPHA-METHYLBENZYL ALCOHOL Preparation Products And Raw materials |
|