|
|
| | (S)-4-Chloro-alpha-methylbenzyl alcohol Basic information |
| | (S)-4-Chloro-alpha-methylbenzyl alcohol Chemical Properties |
| Melting point | 110 °C | | alpha | -48 º (C=1 IN CHLOROFORM) | | Boiling point | 240.6±15.0 °C(Predicted) | | density | 1.175 g/mL at 25 °C | | refractive index | n20/D 1.544 | | Fp | 110 °C | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | pka | 14.22±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]20/D -48.0°, c = 1 in chloroform | | InChI | InChI=1/C8H9ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 | | InChIKey | MVOSNPUNXINWAD-ISZMHOAENA-N | | SMILES | [C@H](C1C=CC(Cl)=CC=1)(O)C |&1:0,r| |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2906290090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (S)-4-Chloro-alpha-methylbenzyl alcohol Usage And Synthesis |
| Uses | (S)-1-(4-Chlorophenyl)ethanol is a building block used in the synthesis of novel N,N’-dimethylpiperazines which display metal binding abilities. | | Uses | (S)-4-Chloro-α-methylbenzyl alcohol can be used as a chiral building block in:
- The enantioselective synthesis of (-)-(S,S)-clemastine.
- The enantioselective and geometrically defined synthesis of chloro methylbenzyl pinacol boronic ester via lithiationborylation methodology.
|
| | (S)-4-Chloro-alpha-methylbenzyl alcohol Preparation Products And Raw materials |
|