| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester Basic information |
| Product Name: | Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester | | Synonyms: | Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester;L-MONOMENTHYLGLUTARATE;L-menthylglutaric acid; Pentanedioic acid,L-Monomenthyl glutarate;laevo-monomenthyl glutarate;5-(((1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl)oxy)-5-oxopentanoic acid;220621-22-7 Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester;(L)-Monomenthane-3-yl carbonate | | CAS: | 220621-22-7 | | MF: | C15H26O4 | | MW: | 270.36 | | EINECS: | | | Product Categories: | | | Mol File: | 220621-22-7.mol | ![Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester Structure](CAS/GIF/220621-22-7.gif) |
| | Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester Chemical Properties |
| Boiling point | 393.4±25.0 °C(Predicted) | | density | 1.0318 | | FEMA | 4006 | L-MONOMENTHYL GLUTARATE | | pka | 4.61±0.10(Predicted) | | Odor | minty menthol | | Odor Type | minty | | JECFA Number | 1414 | | Major Application | flavors and fragrances | | InChI | InChI=1S/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17)/t11-,12+,13-/m1/s1 | | InChIKey | CTMTYSVTTGVYAW-FRRDWIJNSA-N | | SMILES | C(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)(=O)CCCC(O)=O | | LogP | 3.96 |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester Usage And Synthesis |
| Uses | flavors and fragrances | | Synthesis |
A solvent-free reaction to obtain glutaric acid mono-L-menthane ester from glutaric anhydride and menthol, using artificial zeolite as a catalyst, by adding solvent to solubilize, warming up, and then removing the solvent under reduced pressure.
|
| | Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester Preparation Products And Raw materials |
|