|
|
| | Sarafloxacin hydrochloride Basic information |
| | Sarafloxacin hydrochloride Chemical Properties |
| Melting point | >240°C (dec.) | | Fp | >110°(230°F) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | color | Pale Yellow | | Water Solubility | Soluble in water | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | InChI=1S/C20H17F2N3O3.ClH/c21-12-1-3-13(4-2-12)25-11-15(20(27)28)19(26)14-9-16(22)18(10-17(14)25)24-7-5-23-6-8-24;/h1-4,9-11,23H,5-8H2,(H,27,28);1H | | InChIKey | KNWODGJQLCISLC-UHFFFAOYSA-N | | SMILES | C12C=C(C(F)=CC=1C(C(C(=O)O)=CN2C1C=CC(F)=CC=1)=O)N1CCNCC1.Cl | | CAS DataBase Reference | 91296-87-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | Sarafloxacin hydrochloride Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Sarafloxacin is a fluorinated quinolone antibacterial. | | Uses | progestin, antiandrogen | | Uses | A fluoroquinolone antibacterial agent | | Brand name | SaraFlox Injectable (Abbott); SaraFlox WSP (Abbott). |
| | Sarafloxacin hydrochloride Preparation Products And Raw materials |
|