|
|
| Product Name: | Ciprofloxacin hydrochloride | | Synonyms: | Ciprofloxacin base/HCL;CIPROFLOXACINHYDROCHLORIDE(ANHYDROUS);ciprofloxacine hydrochloride;CIPROXAN/1-CYCLOPROPYL-6-FLUORO-1,4-DIHYDRO-4-OXO-7-(1-PIPERAZINYL)-3-QUINOLINECARBOX;1-Cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid hydrochloride;1-cyclopropyl-6-fluoro-4-keto-7-piperazin-1-yl-quinoline-3-carboxylic acid hydrochloride;Ciprofloxacin Impurity 14;fluoroquinolone antibiotic ciprofloxacin hcl | | CAS: | 86483-48-9 | | MF: | C17H18FN3O3.xHCl | | MW: | 367.81 | | EINECS: | 1806241-263-5 | | Product Categories: | Antimicrobial;API;Pharmaceutical intermediates | | Mol File: | 86483-48-9.mol |  |
| | Ciprofloxacin hydrochloride Chemical Properties |
| Melting point | >300 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | color | White to Off-White | | BCS Class | 3/1 | | InChI | InChI=1S/C17H18FN3O3.ClH/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24;/h7-10,19H,1-6H2,(H,23,24);1H | | InChIKey | DIOIOSKKIYDRIQ-UHFFFAOYSA-N | | SMILES | O=C1C(=CN(C2CC2)C2=CC(N3CCNCC3)=C(F)C=C12)C(=O)O.Cl | | CAS DataBase Reference | 86483-48-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 29419000 |
| | Ciprofloxacin hydrochloride Usage And Synthesis |
| Brand Name(s) in US | Cipro and generic forms
| | Uses | Ciprofloxacin hydrochloride, C17H18FN3O3 •HCl•H2O, is a synthetic broad-spectrum antibacterial agent. Ciprofloxacin differs from other quinolones in that it has a fluorine atom at the 6-position, a piperazine moiety at the 7-position, and a cyclopropyl ring at the 1-position. it was the drug of choice forcombating anthrax.
Ciprofloxacin hydrochloride (Cipro, 500-mg tablets) is highly active against the important bacterial causes of enteritis, including diarrheogenic Escherichia coli, Vibrio cholerae, Salmonella species, Shigella species, Campylobacter jejuni, Aeromonas species, and Yersinia enterocolitica.
| | Uses | Ciprofloxacin Hydrochloride Monohydrate is a fluorinated quinolone antibacterial. | | Definition | ChEBI: The anhydrous form of the monohydrochloride salt of ciprofloxacin. |
| | Ciprofloxacin hydrochloride Preparation Products And Raw materials |
|