NAPHTHOL AS-MX PHOSPHATE manufacturers
|
| | NAPHTHOL AS-MX PHOSPHATE Basic information |
| | NAPHTHOL AS-MX PHOSPHATE Chemical Properties |
| Melting point | 189-190°C | | density | 1.419±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | ethanol: 50mg/mL, clear to slightly hazy, colorless to faintly yellow (to Faint Brown) | | pka | 0.80±0.30(Predicted) | | form | powder | | color | White to off-white | | BRN | 6664873 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/C19H18NO5P/c1-12-7-8-17(13(2)9-12)20-19(21)16-10-14-5-3-4-6-15(14)11-18(16)25-26(22,23)24/h3-11H,1-2H3,(H,20,21)(H2,22,23,24) | | InChIKey | IOMLBTHPCVDRHM-UHFFFAOYSA-N | | SMILES | Cc1ccc(NC(=O)c2cc3ccccc3cc2OP(O)(O)=O)c(C)c1 | | CAS DataBase Reference | 1596-56-1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | NAPHTHOL AS-MX PHOSPHATE Usage And Synthesis |
| Chemical Properties | solid | | Uses | Naphthol AS-MX phosphate has been used as:
- a substrate for alkaline phosphatase in human osteoblasts
- mouse embryonic stem cell (mESC)
- coronal plane sections for fluorescence staining and analysis
| | General Description | Naphthol AS-MX phosphate is soluble in dioxane and is a substrate for phosphatase. |
| | NAPHTHOL AS-MX PHOSPHATE Preparation Products And Raw materials |
|