| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
TRIHEXANOIN manufacturers
- TRIHEXANOIN
-
- $1.00
-
2020-01-03
- CAS:621-70-5
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | TRIHEXANOIN Basic information |
| | TRIHEXANOIN Chemical Properties |
| Melting point | -60℃ | | Boiling point | 244 °C / 28mmHg | | density | 0.98 g/mL(lit.) | | refractive index | n20/D 1.442 | | storage temp. | −20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml | | form | Liquid
(Density: 0.98 g/cm3) | | color | Colorless to Light yellow to Light orange | | BRN | 1806732 | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C21H38O6/c1-4-7-10-13-19(22)25-16-18(27-21(24)15-12-9-6-3)17-26-20(23)14-11-8-5-2/h18H,4-17H2,1-3H3 | | InChIKey | MAYCICSNZYXLHB-UHFFFAOYSA-N | | SMILES | CCCCCC(=O)OCC(COC(=O)CCCCC)OC(=O)CCCCC | | LogP | 6.330 (est) | | CAS DataBase Reference | 621-70-5 | | EPA Substance Registry System | Hexanoic acid, 1,2,3-propanetriyl ester (621-70-5) |
| Safety Statements | 23-24/25 | | WGK Germany | 1 | | RTECS | MB2700000 | | TSCA | TSCA listed | | HS Code | 2940.00.6000 | | Storage Class | 11 - Combustible Solids |
| | TRIHEXANOIN Usage And Synthesis |
| Chemical Properties | It is very soluble in alcohol and
ether and insoluble in water. | | Uses | Tricaproin is used as a delivery system for Paclitaxel (P132500) which is an anticancer agent. | | Definition | ChEBI: A triglyceride obtained by condensation of each of the three hydroxy groups of glycerol with hexanoic (caproic) acid. |
| | TRIHEXANOIN Preparation Products And Raw materials |
|