|
|
| | COPPER (II) TRIFLUOROACETATE Basic information |
| | COPPER (II) TRIFLUOROACETATE Chemical Properties |
| storage temp. | Store at room temperature | | solubility | Water (Slightly) | | form | Crystalline | | Appearance | Light blue to blue Solid | | InChI | 1S/2C2HF3O2.Cu.H2O/c2*3-2(4,5)1(6)7;;/h2*(H,6,7);;1H2/q;;+2;/p-2 | | InChIKey | JIDMEYQIXXJQCC-UHFFFAOYSA-L | | SMILES | O.FC(F)(F)C(=O)O[Cu]OC(=O)C(F)(F)F | | CAS DataBase Reference | 123333-88-0 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29159000 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | COPPER (II) TRIFLUOROACETATE Usage And Synthesis |
| Uses | As Heterogeneous Catalysts. It is suitable for use as an electrocatalyst in gas diffusion electrodes. As Electrochemical gas sensors. As organic intermediate, as reagent. | | reaction suitability | core: copper |
| | COPPER (II) TRIFLUOROACETATE Preparation Products And Raw materials |
|