| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Copper (II) trifluoroacetate Basic information |
| Product Name: | Copper (II) trifluoroacetate | | Synonyms: | Coppertrifluoroacetatehydrate;2,2,2-Trifluoroacetic acid copper(2+) salt hydrate;2,2,2-trifluoroacetate hydrate;Copper(II) 2,2,2-trifluoroacetate hydrate;COPPER (II) TRIFLUOROACETATE ISO 9001:2015 REACH;Aceticacid, 2,2,2-trifluoro-, copper(2+) salt, hydrate (2:1:?);Copper(II) 2,2,2-trifluoroacetate hydrate 97%;Copper (II) trifluoroacetate | | CAS: | 123333-88-0 | | MF: | C2H3CuF3O3 | | MW: | 195.58 | | EINECS: | | | Product Categories: | Copper;Micro/Nanoelectronics;Solution Deposition Precursors | | Mol File: | 123333-88-0.mol |  |
| | Copper (II) trifluoroacetate Chemical Properties |
| storage temp. | Store at room temperature | | solubility | Water (Slightly) | | form | Crystalline | | Appearance | Light blue to blue Solid | | InChI | 1S/2C2HF3O2.Cu.H2O/c2*3-2(4,5)1(6)7;;/h2*(H,6,7);;1H2/q;;+2;/p-2 | | InChIKey | JIDMEYQIXXJQCC-UHFFFAOYSA-L | | SMILES | O.FC(F)(F)C(=O)O[Cu]OC(=O)C(F)(F)F | | CAS DataBase Reference | 123333-88-0 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29159000 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | Copper (II) trifluoroacetate Usage And Synthesis |
| Uses | As Heterogeneous Catalysts. It is suitable for use as an electrocatalyst in gas diffusion electrodes. As Electrochemical gas sensors. As organic intermediate, as reagent. | | reaction suitability | core: copper |
| | Copper (II) trifluoroacetate Preparation Products And Raw materials |
|