|
|
| | 3-FLUORO-2-METHYLBENZOIC ACID Basic information |
| | 3-FLUORO-2-METHYLBENZOIC ACID Chemical Properties |
| Melting point | 158-160 °C (lit.) | | Boiling point | 261.2±20.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline powder | | pka | 3.61±0.10(Predicted) | | color | White | | InChI | InChI=1S/C8H7FO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) | | InChIKey | XMKZAIHFVHJGPV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(F)=C1C | | CAS DataBase Reference | 699-90-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids |
| | 3-FLUORO-2-METHYLBENZOIC ACID Usage And Synthesis |
| Chemical Properties | off white powder | | Uses | 3-Fluoro-2-methylbenzoic acid was used in the GC-MS detection of metabolites from cell cultures containing 6-fluoro-3-methylphenol. | | General Description | 3-Fluoro-2-methylbenzoic acid is an aryl fluorinated building block. |
| | 3-FLUORO-2-METHYLBENZOIC ACID Preparation Products And Raw materials |
|