| Company Name: |
Shangfluoro Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_2@163.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Tetrafluorophthalic acid Basic information |
| Product Name: | Tetrafluorophthalic acid | | Synonyms: | 1,2-Benzenedicarboxylic acid, 3,4,5,6-tetrafluoro-;RARECHEM AL BO 0016;TETRAFLUOROPHTHALIC ACID;3,4,5,6-TETRAFLUOROBENZENE-1,2-DICARBOXYLIC ACID;Tetrafluorophthalicacid,97%;3,4,5,6-Tetrafluorophthalic;2,3,4,5-TETRAFLUORO-PHTHALIC ACID;TETRAFLUOROPHTHALIC ACID 90% | | CAS: | 652-03-9 | | MF: | C8H2F4O4 | | MW: | 238.09 | | EINECS: | 211-483-4 | | Product Categories: | Phthalic Acids, Esters and Derivatives;API intermediates;Carboxylic Acid Monomers;Monomers;Polymer Science | | Mol File: | 652-03-9.mol |  |
| | Tetrafluorophthalic acid Chemical Properties |
| Melting point | 152-154 °C(lit.) | | Boiling point | 345.7±42.0 °C(Predicted) | | density | 1.6239 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | pka | 1.28±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | BRN | 2057012 | | InChI | InChI=1S/C8H2F4O4/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11/h(H,13,14)(H,15,16) | | InChIKey | YJLVXRPNNDKMMO-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=C(F)C(F)=C(F)C(F)=C1C(O)=O | | CAS DataBase Reference | 652-03-9(CAS DataBase Reference) | | NIST Chemistry Reference | Tetrafluorophthalic acid(652-03-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-37/38-36 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetrafluorophthalic acid Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powder | | Uses | Tetrafluorophthalic Acid, can be used as a starting material in the synthesis of various chemical compounds such as Perfluoroanthracene (P227605), a perfluorinated graded index polymer optical fiber (PFGI-POF) component. |
| | Tetrafluorophthalic acid Preparation Products And Raw materials |
|